C26H32N2O4S2 — CID 142976535
N-hydroxy-7-[4-(4-propan-2-ylphenyl)-N-thiophen-2-ylsulfonylanilino]heptanamide (PubChem CID 142976535) has the molecular formula C26H32N2O4S2 and a molecular weight of 500.69 g/mol. Its IUPAC name is N-hydroxy-7-[4-(4-propan-2-ylphenyl)-N-thiophen-2-ylsulfonylanilino]heptanamide.
| Compound Name | N-hydroxy-7-[4-(4-propan-2-ylphenyl)-N-thiophen-2-ylsulfonylanilino]heptanamide |
|---|---|
| PubChem CID | 142976535 |
| Molecular Formula | C26H32N2O4S2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | N-hydroxy-7-[4-(4-propan-2-ylphenyl)-N-thiophen-2-ylsulfonylanilino]heptanamide |
| SMILES | CC(C)c1ccc(-c2ccc(N(CCCCCCC(=O)NO)S(=O)(=O)c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C26H32N2O4S2/c1-20(2)21-10-12-22(13-11-21)23-14-16-24(17-15-23)28(34(31,32)26-9-7-19-33-26)18-6-4-3-5-8-25(29)27-30/h7,9-17,19-20,30H,3-6,8,18H2,1-2H3,(H,27,29) |
| InChIKey | SEOLXNKTUHHZSO-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|