C25H26N2O5S2 — CID 11329486
7-[4-(1-benzofuran-2-yl)-N-thiophen-2-ylsulfonylanilino]-N-hydroxyheptanamide (PubChem CID 11329486) has the molecular formula C25H26N2O5S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 7-[4-(1-benzofuran-2-yl)-N-thiophen-2-ylsulfonylanilino]-N-hydroxyheptanamide.
| Compound Name | 7-[4-(1-benzofuran-2-yl)-N-thiophen-2-ylsulfonylanilino]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 11329486 |
| Molecular Formula | C25H26N2O5S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 7-[4-(1-benzofuran-2-yl)-N-thiophen-2-ylsulfonylanilino]-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCCN(c1ccc(-c2cc3ccccc3o2)cc1)S(=O)(=O)c1cccs1)NO |
| InChI | InChI=1S/C25H26N2O5S2/c28-24(26-29)10-3-1-2-6-16-27(34(30,31)25-11-7-17-33-25)21-14-12-19(13-15-21)23-18-20-8-4-5-9-22(20)32-23/h4-5,7-9,11-15,17-18,29H,1-3,6,10,16H2,(H,26,28) |
| InChIKey | RRLZBZCTODJIPJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|