C25H29N3O4S — CID 142976542
7-[3,4-dihydronaphthalen-1-ylsulfonyl(1H-indol-5-yl)amino]-N-hydroxyheptanamide (PubChem CID 142976542) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is 7-[3,4-dihydronaphthalen-1-ylsulfonyl(1H-indol-5-yl)amino]-N-hydroxyheptanamide.
| Compound Name | 7-[3,4-dihydronaphthalen-1-ylsulfonyl(1H-indol-5-yl)amino]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 142976542 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 7-[3,4-dihydronaphthalen-1-ylsulfonyl(1H-indol-5-yl)amino]-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCCN(c1ccc2[nH]ccc2c1)S(=O)(=O)C1=CCCc2ccccc21)NO |
| InChI | InChI=1S/C25H29N3O4S/c29-25(27-30)12-3-1-2-6-17-28(21-13-14-23-20(18-21)15-16-26-23)33(31,32)24-11-7-9-19-8-4-5-10-22(19)24/h4-5,8,10-11,13-16,18,26,30H,1-3,6-7,9,12,17H2,(H,27,29) |
| InChIKey | UVWMWNZHCRSPCY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|