C27H29N3O4S — CID 87113790
N-hydroxy-7-[[2-[4-(1H-indol-6-yl)phenyl]phenyl]sulfonylamino]heptanamide (PubChem CID 87113790) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is N-hydroxy-7-[[2-[4-(1H-indol-6-yl)phenyl]phenyl]sulfonylamino]heptanamide.
| Compound Name | N-hydroxy-7-[[2-[4-(1H-indol-6-yl)phenyl]phenyl]sulfonylamino]heptanamide |
|---|---|
| PubChem CID | 87113790 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-hydroxy-7-[[2-[4-(1H-indol-6-yl)phenyl]phenyl]sulfonylamino]heptanamide |
| SMILES | O=C(CCCCCCNS(=O)(=O)c1ccccc1-c1ccc(-c2ccc3cc[nH]c3c2)cc1)NO |
| InChI | InChI=1S/C27H29N3O4S/c31-27(30-32)9-3-1-2-6-17-29-35(33,34)26-8-5-4-7-24(26)21-12-10-20(11-13-21)23-15-14-22-16-18-28-25(22)19-23/h4-5,7-8,10-16,18-19,28-29,32H,1-3,6,9,17H2,(H,30,31) |
| InChIKey | SGOGPRRNWXNUHX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|