C12H15N3O3S — CID 47343118
N-(3-sulfamoylpropyl)-1H-indole-6-carboxamide (PubChem CID 47343118) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-(3-sulfamoylpropyl)-1H-indole-6-carboxamide.
| Compound Name | N-(3-sulfamoylpropyl)-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 47343118 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-(3-sulfamoylpropyl)-1H-indole-6-carboxamide |
| SMILES | NS(=O)(=O)CCCNC(=O)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C12H15N3O3S/c13-19(17,18)7-1-5-15-12(16)10-3-2-9-4-6-14-11(9)8-10/h2-4,6,8,14H,1,5,7H2,(H,15,16)(H2,13,17,18) |
| InChIKey | IZDFPEKCVNZYRK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|