C29H32N4O4 — CID 58074153
N-hydroxy-7-[4-(1H-indol-6-yl)-N-[(4-methoxyphenyl)carbamoyl]anilino]heptanamide (PubChem CID 58074153) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is N-hydroxy-7-[4-(1H-indol-6-yl)-N-[(4-methoxyphenyl)carbamoyl]anilino]heptanamide.
| Compound Name | N-hydroxy-7-[4-(1H-indol-6-yl)-N-[(4-methoxyphenyl)carbamoyl]anilino]heptanamide |
|---|---|
| PubChem CID | 58074153 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | N-hydroxy-7-[4-(1H-indol-6-yl)-N-[(4-methoxyphenyl)carbamoyl]anilino]heptanamide |
| SMILES | COc1ccc(NC(=O)N(CCCCCCC(=O)NO)c2ccc(-c3ccc4cc[nH]c4c3)cc2)cc1 |
| InChI | InChI=1S/C29H32N4O4/c1-37-26-15-11-24(12-16-26)31-29(35)33(19-5-3-2-4-6-28(34)32-36)25-13-9-21(10-14-25)23-8-7-22-17-18-30-27(22)20-23/h7-18,20,30,36H,2-6,19H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | BDMZHKPLGWQJFD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|