C25H30N4O6 — CID 155524459
N-hydroxy-N'-(4-methoxyphenyl)-N'-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]octanediamide (PubChem CID 155524459) has the molecular formula C25H30N4O6 and a molecular weight of 482.54 g/mol. Its IUPAC name is N-hydroxy-N'-(4-methoxyphenyl)-N'-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]octanediamide.
| Compound Name | N-hydroxy-N'-(4-methoxyphenyl)-N'-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]octanediamide |
|---|---|
| PubChem CID | 155524459 |
| Molecular Formula | C25H30N4O6 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | N-hydroxy-N'-(4-methoxyphenyl)-N'-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]octanediamide |
| SMILES | COc1ccc(-c2noc(CN(C(=O)CCCCCCC(=O)NO)c3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C25H30N4O6/c1-33-20-13-9-18(10-14-20)25-26-23(35-28-25)17-29(19-11-15-21(34-2)16-12-19)24(31)8-6-4-3-5-7-22(30)27-32/h9-16,32H,3-8,17H2,1-2H3,(H,27,30) |
| InChIKey | JXGOYRJLOOQWDO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|