C23H25N5O7 — CID 155552157
N-hydroxy-N'-(4-methoxyphenyl)-N'-[[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]methyl]heptanediamide (PubChem CID 155552157) has the molecular formula C23H25N5O7 and a molecular weight of 483.48 g/mol. Its IUPAC name is N-hydroxy-N'-(4-methoxyphenyl)-N'-[[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]methyl]heptanediamide.
| Compound Name | N-hydroxy-N'-(4-methoxyphenyl)-N'-[[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]methyl]heptanediamide |
|---|---|
| PubChem CID | 155552157 |
| Molecular Formula | C23H25N5O7 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-hydroxy-N'-(4-methoxyphenyl)-N'-[[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]methyl]heptanediamide |
| SMILES | COc1ccc(N(Cc2noc(-c3ccc([N+](=O)[O-])cc3)n2)C(=O)CCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C23H25N5O7/c1-34-19-13-11-17(12-14-19)27(22(30)6-4-2-3-5-21(29)25-31)15-20-24-23(35-26-20)16-7-9-18(10-8-16)28(32)33/h7-14,31H,2-6,15H2,1H3,(H,25,29) |
| InChIKey | TXIBORCMEKKHJT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 160.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|