C22H21ClN4O7 — CID 55935205
[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55935205) has the molecular formula C22H21ClN4O7 and a molecular weight of 488.88 g/mol. Its IUPAC name is [5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55935205 |
| Molecular Formula | C22H21ClN4O7 |
| Molecular Weight | 488.88 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | [5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | COc1ccc(-c2nc(COC(=O)[C@@H](NC(=O)c3ccc([N+](=O)[O-])cc3Cl)C(C)C)no2)cc1 |
| InChI | InChI=1S/C22H21ClN4O7/c1-12(2)19(25-20(28)16-9-6-14(27(30)31)10-17(16)23)22(29)33-11-18-24-21(34-26-18)13-4-7-15(32-3)8-5-13/h4-10,12,19H,11H2,1-3H3,(H,25,28)/t19-/m0/s1 |
| InChIKey | AAEJNAPLNKRGTF-IBGZPJMESA-N |
| XLogP | 3.80 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.88 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|