C20H19ClN4O5 — CID 17382619
2-chloro-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-nitro-N-propan-2-ylbenzamide (PubChem CID 17382619) has the molecular formula C20H19ClN4O5 and a molecular weight of 430.85 g/mol. Its IUPAC name is 2-chloro-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-nitro-N-propan-2-ylbenzamide.
| Compound Name | 2-chloro-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 17382619 |
| Molecular Formula | C20H19ClN4O5 |
| Molecular Weight | 430.85 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-chloro-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-nitro-N-propan-2-ylbenzamide |
| SMILES | COc1ccc(-c2noc(CN(C(=O)c3ccc([N+](=O)[O-])cc3Cl)C(C)C)n2)cc1 |
| InChI | InChI=1S/C20H19ClN4O5/c1-12(2)24(20(26)16-9-6-14(25(27)28)10-17(16)21)11-18-22-19(23-30-18)13-4-7-15(29-3)8-5-13/h4-10,12H,11H2,1-3H3 |
| InChIKey | JBKXULCOPMYEIJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 111.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.85 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|