C30H42N4O3 — CID 142976499
7-[formyl(1H-indol-5-yl)amino]-N-hydroxyheptanamide;(E)-N-methylbut-2-en-2-amine;prop-2-enylbenzene (PubChem CID 142976499) has the molecular formula C30H42N4O3 and a molecular weight of 506.69 g/mol. Its IUPAC name is 7-[formyl(1H-indol-5-yl)amino]-N-hydroxyheptanamide;(E)-N-methylbut-2-en-2-amine;prop-2-enylbenzene.
| Compound Name | 7-[formyl(1H-indol-5-yl)amino]-N-hydroxyheptanamide;(E)-N-methylbut-2-en-2-amine;prop-2-enylbenzene |
|---|---|
| PubChem CID | 142976499 |
| Molecular Formula | C30H42N4O3 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.33 |
| IUPAC Name | 7-[formyl(1H-indol-5-yl)amino]-N-hydroxyheptanamide;(E)-N-methylbut-2-en-2-amine;prop-2-enylbenzene |
| SMILES | C/C=C(\C)NC.C=CCc1ccccc1.O=CN(CCCCCCC(=O)NO)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C16H21N3O3.C9H10.C5H11N/c20-12-19(10-4-2-1-3-5-16(21)18-22)14-6-7-15-13(11-14)8-9-17-15;1-2-6-9-7-4-3-5-8-9;1-4-5(2)6-3/h6-9,11-12,17,22H,1-5,10H2,(H,18,21);2-5,7-8H,1,6H2;4,6H,1-3H3/b;;5-4+ |
| InChIKey | DDQSVGSFRNOUSP-XMOYFUIDSA-N |
| XLogP | 6.13 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|