C18H16Cl2N2O4S — CID 152669052
2-[(3,5-dichlorophenyl)sulfonyl-(1H-indol-5-yl)amino]ethyl acetate (PubChem CID 152669052) has the molecular formula C18H16Cl2N2O4S and a molecular weight of 427.31 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)sulfonyl-(1H-indol-5-yl)amino]ethyl acetate.
| Compound Name | 2-[(3,5-dichlorophenyl)sulfonyl-(1H-indol-5-yl)amino]ethyl acetate |
|---|---|
| PubChem CID | 152669052 |
| Molecular Formula | C18H16Cl2N2O4S |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)sulfonyl-(1H-indol-5-yl)amino]ethyl acetate |
| SMILES | CC(=O)OCCN(c1ccc2[nH]ccc2c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2N2O4S/c1-12(23)26-7-6-22(16-2-3-18-13(8-16)4-5-21-18)27(24,25)17-10-14(19)9-15(20)11-17/h2-5,8-11,21H,6-7H2,1H3 |
| InChIKey | ZLDBJDSORYAQHI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |