C17H17Cl2N2O5PS — CID 88588690
[(3,5-dichlorophenyl)sulfonyl-(1H-indol-5-yl)amino]methyl-ethoxyphosphinic acid (PubChem CID 88588690) has the molecular formula C17H17Cl2N2O5PS and a molecular weight of 463.28 g/mol. Its IUPAC name is [(3,5-dichlorophenyl)sulfonyl-(1H-indol-5-yl)amino]methyl-ethoxyphosphinic acid.
| Compound Name | [(3,5-dichlorophenyl)sulfonyl-(1H-indol-5-yl)amino]methyl-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 88588690 |
| Molecular Formula | C17H17Cl2N2O5PS |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | [(3,5-dichlorophenyl)sulfonyl-(1H-indol-5-yl)amino]methyl-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)CN(c1ccc2[nH]ccc2c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N2O5PS/c1-2-26-27(22,23)11-21(15-3-4-17-12(7-15)5-6-20-17)28(24,25)16-9-13(18)8-14(19)10-16/h3-10,20H,2,11H2,1H3,(H,22,23) |
| InChIKey | PJOFKTPEIXCEGX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|