C19H17Cl2N4O5PS — CID 25147517
[(3,5-dichlorophenyl)sulfonyl-(1-pyrimidin-2-yl-2,3-dihydroindol-5-yl)amino]methylphosphonic acid (PubChem CID 25147517) has the molecular formula C19H17Cl2N4O5PS and a molecular weight of 515.32 g/mol. Its IUPAC name is [(3,5-dichlorophenyl)sulfonyl-(1-pyrimidin-2-yl-2,3-dihydroindol-5-yl)amino]methylphosphonic acid.
| Compound Name | [(3,5-dichlorophenyl)sulfonyl-(1-pyrimidin-2-yl-2,3-dihydroindol-5-yl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 25147517 |
| Molecular Formula | C19H17Cl2N4O5PS |
| Molecular Weight | 515.32 g/mol |
| Exact Mass | 514.00 |
| IUPAC Name | [(3,5-dichlorophenyl)sulfonyl-(1-pyrimidin-2-yl-2,3-dihydroindol-5-yl)amino]methylphosphonic acid |
| SMILES | O=P(O)(O)CN(c1ccc2c(c1)CCN2c1ncccn1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H17Cl2N4O5PS/c20-14-9-15(21)11-17(10-14)32(29,30)25(12-31(26,27)28)16-2-3-18-13(8-16)4-7-24(18)19-22-5-1-6-23-19/h1-3,5-6,8-11H,4,7,12H2,(H2,26,27,28) |
| InChIKey | QEDMEHMHIZXWDJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|