C21H15Cl2N4O5PS — CID 59446468
[[1-(5-cyano-2-pyridinyl)indol-5-yl]-(3,5-dichlorophenyl)sulfonylamino]methylphosphonic acid (PubChem CID 59446468) has the molecular formula C21H15Cl2N4O5PS and a molecular weight of 537.32 g/mol. Its IUPAC name is [[1-(5-cyano-2-pyridinyl)indol-5-yl]-(3,5-dichlorophenyl)sulfonylamino]methylphosphonic acid.
| Compound Name | [[1-(5-cyano-2-pyridinyl)indol-5-yl]-(3,5-dichlorophenyl)sulfonylamino]methylphosphonic acid |
|---|---|
| PubChem CID | 59446468 |
| Molecular Formula | C21H15Cl2N4O5PS |
| Molecular Weight | 537.32 g/mol |
| Exact Mass | 535.99 |
| IUPAC Name | [[1-(5-cyano-2-pyridinyl)indol-5-yl]-(3,5-dichlorophenyl)sulfonylamino]methylphosphonic acid |
| SMILES | N#Cc1ccc(-n2ccc3cc(N(CP(=O)(O)O)S(=O)(=O)c4cc(Cl)cc(Cl)c4)ccc32)nc1 |
| InChI | InChI=1S/C21H15Cl2N4O5PS/c22-16-8-17(23)10-19(9-16)34(31,32)27(13-33(28,29)30)18-2-3-20-15(7-18)5-6-26(20)21-4-1-14(11-24)12-25-21/h1-10,12H,13H2,(H2,28,29,30) |
| InChIKey | IXFSBNGOBWTMAV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 136.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|