C23H15Cl2N3O4S — CID 59277065
2-[[1-(2-cyanophenyl)indol-5-yl]-(3,5-dichlorophenyl)sulfonylamino]acetic acid (PubChem CID 59277065) has the molecular formula C23H15Cl2N3O4S and a molecular weight of 500.36 g/mol. Its IUPAC name is 2-[[1-(2-cyanophenyl)indol-5-yl]-(3,5-dichlorophenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[[1-(2-cyanophenyl)indol-5-yl]-(3,5-dichlorophenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 59277065 |
| Molecular Formula | C23H15Cl2N3O4S |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | 2-[[1-(2-cyanophenyl)indol-5-yl]-(3,5-dichlorophenyl)sulfonylamino]acetic acid |
| SMILES | N#Cc1ccccc1-n1ccc2cc(N(CC(=O)O)S(=O)(=O)c3cc(Cl)cc(Cl)c3)ccc21 |
| InChI | InChI=1S/C23H15Cl2N3O4S/c24-17-10-18(25)12-20(11-17)33(31,32)28(14-23(29)30)19-5-6-22-15(9-19)7-8-27(22)21-4-2-1-3-16(21)13-26/h1-12H,14H2,(H,29,30) |
| InChIKey | BUHCRNUSNQPUIF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |