C26H18Cl2N2O4S — CID 59277445
2-[(3,5-dichlorophenyl)sulfonyl-(1-naphthalen-2-ylindol-5-yl)amino]acetic acid (PubChem CID 59277445) has the molecular formula C26H18Cl2N2O4S and a molecular weight of 525.41 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)sulfonyl-(1-naphthalen-2-ylindol-5-yl)amino]acetic acid.
| Compound Name | 2-[(3,5-dichlorophenyl)sulfonyl-(1-naphthalen-2-ylindol-5-yl)amino]acetic acid |
|---|---|
| PubChem CID | 59277445 |
| Molecular Formula | C26H18Cl2N2O4S |
| Molecular Weight | 525.41 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)sulfonyl-(1-naphthalen-2-ylindol-5-yl)amino]acetic acid |
| SMILES | O=C(O)CN(c1ccc2c(ccn2-c2ccc3ccccc3c2)c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C26H18Cl2N2O4S/c27-20-13-21(28)15-24(14-20)35(33,34)30(16-26(31)32)23-7-8-25-19(12-23)9-10-29(25)22-6-5-17-3-1-2-4-18(17)11-22/h1-15H,16H2,(H,31,32) |
| InChIKey | YQYVGBIUCDVIAO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.41 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |