C17H14Cl3N2O6PS — CID 87469905
[[1-(2-chloroacetyl)indol-5-yl]-(3,5-dichlorophenyl)sulfonylamino]methylphosphonic acid (PubChem CID 87469905) has the molecular formula C17H14Cl3N2O6PS and a molecular weight of 511.71 g/mol. Its IUPAC name is [[1-(2-chloroacetyl)indol-5-yl]-(3,5-dichlorophenyl)sulfonylamino]methylphosphonic acid.
| Compound Name | [[1-(2-chloroacetyl)indol-5-yl]-(3,5-dichlorophenyl)sulfonylamino]methylphosphonic acid |
|---|---|
| PubChem CID | 87469905 |
| Molecular Formula | C17H14Cl3N2O6PS |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 509.94 |
| IUPAC Name | [[1-(2-chloroacetyl)indol-5-yl]-(3,5-dichlorophenyl)sulfonylamino]methylphosphonic acid |
| SMILES | O=C(CCl)n1ccc2cc(N(CP(=O)(O)O)S(=O)(=O)c3cc(Cl)cc(Cl)c3)ccc21 |
| InChI | InChI=1S/C17H14Cl3N2O6PS/c18-9-17(23)21-4-3-11-5-14(1-2-16(11)21)22(10-29(24,25)26)30(27,28)15-7-12(19)6-13(20)8-15/h1-8H,9-10H2,(H2,24,25,26) |
| InChIKey | PASMOOQXERQGBY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|