C28H26Cl2N2O5S — CID 91338273
butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(2-phenylacetyl)indol-5-yl]amino]acetate (PubChem CID 91338273) has the molecular formula C28H26Cl2N2O5S and a molecular weight of 573.50 g/mol. Its IUPAC name is butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(2-phenylacetyl)indol-5-yl]amino]acetate.
| Compound Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(2-phenylacetyl)indol-5-yl]amino]acetate |
|---|---|
| PubChem CID | 91338273 |
| Molecular Formula | C28H26Cl2N2O5S |
| Molecular Weight | 573.50 g/mol |
| Exact Mass | 572.09 |
| IUPAC Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(2-phenylacetyl)indol-5-yl]amino]acetate |
| SMILES | CCCCOC(=O)CN(c1ccc2c(ccn2C(=O)Cc2ccccc2)c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C28H26Cl2N2O5S/c1-2-3-13-37-28(34)19-32(38(35,36)25-17-22(29)16-23(30)18-25)24-9-10-26-21(15-24)11-12-31(26)27(33)14-20-7-5-4-6-8-20/h4-12,15-18H,2-3,13-14,19H2,1H3 |
| InChIKey | RPNNPDQCWFOCLW-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.50 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|