C30H29Cl2N3O5S — CID 123818666
butyl 2-[[7-(benzylcarbamoylamino)naphthalen-2-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate (PubChem CID 123818666) has the molecular formula C30H29Cl2N3O5S and a molecular weight of 614.55 g/mol. Its IUPAC name is butyl 2-[[7-(benzylcarbamoylamino)naphthalen-2-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate.
| Compound Name | butyl 2-[[7-(benzylcarbamoylamino)naphthalen-2-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 123818666 |
| Molecular Formula | C30H29Cl2N3O5S |
| Molecular Weight | 614.55 g/mol |
| Exact Mass | 613.12 |
| IUPAC Name | butyl 2-[[7-(benzylcarbamoylamino)naphthalen-2-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate |
| SMILES | CCCCOC(=O)CN(c1ccc2ccc(NC(=O)NCc3ccccc3)cc2c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C30H29Cl2N3O5S/c1-2-3-13-40-29(36)20-35(41(38,39)28-17-24(31)16-25(32)18-28)27-12-10-22-9-11-26(14-23(22)15-27)34-30(37)33-19-21-7-5-4-6-8-21/h4-12,14-18H,2-3,13,19-20H2,1H3,(H2,33,34,37) |
| InChIKey | AFQJTBBDIQGZBF-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.55 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|