C31H28Cl2N4O5S — CID 91166753
butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(6-phenylmethoxypyridazin-3-yl)indol-5-yl]amino]acetate (PubChem CID 91166753) has the molecular formula C31H28Cl2N4O5S and a molecular weight of 639.56 g/mol. Its IUPAC name is butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(6-phenylmethoxypyridazin-3-yl)indol-5-yl]amino]acetate.
| Compound Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(6-phenylmethoxypyridazin-3-yl)indol-5-yl]amino]acetate |
|---|---|
| PubChem CID | 91166753 |
| Molecular Formula | C31H28Cl2N4O5S |
| Molecular Weight | 639.56 g/mol |
| Exact Mass | 638.12 |
| IUPAC Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(6-phenylmethoxypyridazin-3-yl)indol-5-yl]amino]acetate |
| SMILES | CCCCOC(=O)CN(c1ccc2c(ccn2-c2ccc(OCc3ccccc3)nn2)c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C31H28Cl2N4O5S/c1-2-3-15-41-31(38)20-37(43(39,40)27-18-24(32)17-25(33)19-27)26-9-10-28-23(16-26)13-14-36(28)29-11-12-30(35-34-29)42-21-22-7-5-4-6-8-22/h4-14,16-19H,2-3,15,20-21H2,1H3 |
| InChIKey | WKXYIVYGSIAKDN-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.56 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|