C27H24Cl2N4O5S — CID 59277164
tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-[6-(3-hydroxyprop-1-ynyl)pyridazin-3-yl]indol-5-yl]amino]acetate (PubChem CID 59277164) has the molecular formula C27H24Cl2N4O5S and a molecular weight of 587.49 g/mol. Its IUPAC name is tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-[6-(3-hydroxyprop-1-ynyl)pyridazin-3-yl]indol-5-yl]amino]acetate.
| Compound Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-[6-(3-hydroxyprop-1-ynyl)pyridazin-3-yl]indol-5-yl]amino]acetate |
|---|---|
| PubChem CID | 59277164 |
| Molecular Formula | C27H24Cl2N4O5S |
| Molecular Weight | 587.49 g/mol |
| Exact Mass | 586.08 |
| IUPAC Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-[6-(3-hydroxyprop-1-ynyl)pyridazin-3-yl]indol-5-yl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(c1ccc2c(ccn2-c2ccc(C#CCO)nn2)c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C27H24Cl2N4O5S/c1-27(2,3)38-26(35)17-33(39(36,37)23-15-19(28)14-20(29)16-23)22-7-8-24-18(13-22)10-11-32(24)25-9-6-21(30-31-25)5-4-12-34/h6-11,13-16,34H,12,17H2,1-3H3 |
| InChIKey | IXCHPKVTUFCREU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|