C28H29Cl2N5O4S — CID 89248781
tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-[6-(2-methylprop-2-enylamino)pyridazin-3-yl]indol-5-yl]amino]acetate (PubChem CID 89248781) has the molecular formula C28H29Cl2N5O4S and a molecular weight of 602.54 g/mol. Its IUPAC name is tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-[6-(2-methylprop-2-enylamino)pyridazin-3-yl]indol-5-yl]amino]acetate.
| Compound Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-[6-(2-methylprop-2-enylamino)pyridazin-3-yl]indol-5-yl]amino]acetate |
|---|---|
| PubChem CID | 89248781 |
| Molecular Formula | C28H29Cl2N5O4S |
| Molecular Weight | 602.54 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-[6-(2-methylprop-2-enylamino)pyridazin-3-yl]indol-5-yl]amino]acetate |
| SMILES | C=C(C)CNc1ccc(-n2ccc3cc(N(CC(=O)OC(C)(C)C)S(=O)(=O)c4cc(Cl)cc(Cl)c4)ccc32)nn1 |
| InChI | InChI=1S/C28H29Cl2N5O4S/c1-18(2)16-31-25-8-9-26(33-32-25)34-11-10-19-12-22(6-7-24(19)34)35(17-27(36)39-28(3,4)5)40(37,38)23-14-20(29)13-21(30)15-23/h6-15H,1,16-17H2,2-5H3,(H,31,32) |
| InChIKey | PEOWJCLDULUCGJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|