C27H25Cl2N3O5S — CID 90701568
butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(phenylcarbamoyl)indol-5-yl]amino]acetate (PubChem CID 90701568) has the molecular formula C27H25Cl2N3O5S and a molecular weight of 574.49 g/mol. Its IUPAC name is butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(phenylcarbamoyl)indol-5-yl]amino]acetate.
| Compound Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(phenylcarbamoyl)indol-5-yl]amino]acetate |
|---|---|
| PubChem CID | 90701568 |
| Molecular Formula | C27H25Cl2N3O5S |
| Molecular Weight | 574.49 g/mol |
| Exact Mass | 573.09 |
| IUPAC Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(phenylcarbamoyl)indol-5-yl]amino]acetate |
| SMILES | CCCCOC(=O)CN(c1ccc2c(ccn2C(=O)Nc2ccccc2)c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C27H25Cl2N3O5S/c1-2-3-13-37-26(33)18-32(38(35,36)24-16-20(28)15-21(29)17-24)23-9-10-25-19(14-23)11-12-31(25)27(34)30-22-7-5-4-6-8-22/h4-12,14-17H,2-3,13,18H2,1H3,(H,30,34) |
| InChIKey | NAXZNNQNOKKKGP-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.49 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|