C25H25Cl2N3O6S — CID 91590037
butyl 2-[(3,5-dichlorophenyl)sulfonyl-[10-(dimethylamino)-11-methyl-2,3-dioxo-11-azatricyclo[6.2.1.04,9]undeca-1(10),4(9),5,7-tetraen-6-yl]amino]acetate (PubChem CID 91590037) has the molecular formula C25H25Cl2N3O6S and a molecular weight of 566.46 g/mol. Its IUPAC name is butyl 2-[(3,5-dichlorophenyl)sulfonyl-[10-(dimethylamino)-11-methyl-2,3-dioxo-11-azatricyclo[6.2.1.04,9]undeca-1(10),4(9),5,7-tetraen-6-yl]amino]acetate.
| Compound Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[10-(dimethylamino)-11-methyl-2,3-dioxo-11-azatricyclo[6.2.1.04,9]undeca-1(10),4(9),5,7-tetraen-6-yl]amino]acetate |
|---|---|
| PubChem CID | 91590037 |
| Molecular Formula | C25H25Cl2N3O6S |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[10-(dimethylamino)-11-methyl-2,3-dioxo-11-azatricyclo[6.2.1.04,9]undeca-1(10),4(9),5,7-tetraen-6-yl]amino]acetate |
| SMILES | CCCCOC(=O)CN(c1cc2c3c(N(C)C)c(n(C)c3c1)C(=O)C2=O)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C25H25Cl2N3O6S/c1-5-6-7-36-20(31)13-30(37(34,35)17-9-14(26)8-15(27)10-17)16-11-18-21-19(12-16)29(4)23(22(21)28(2)3)25(33)24(18)32/h8-12H,5-7,13H2,1-4H3 |
| InChIKey | PHJDSFKLHUDNDM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 105.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|