C31H27Cl2N3O5S — CID 90700402
butyl 2-[[5-(5-benzyl-1,2,4-oxadiazol-3-yl)naphthalen-2-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate (PubChem CID 90700402) has the molecular formula C31H27Cl2N3O5S and a molecular weight of 624.55 g/mol. Its IUPAC name is butyl 2-[[5-(5-benzyl-1,2,4-oxadiazol-3-yl)naphthalen-2-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate.
| Compound Name | butyl 2-[[5-(5-benzyl-1,2,4-oxadiazol-3-yl)naphthalen-2-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 90700402 |
| Molecular Formula | C31H27Cl2N3O5S |
| Molecular Weight | 624.55 g/mol |
| Exact Mass | 623.10 |
| IUPAC Name | butyl 2-[[5-(5-benzyl-1,2,4-oxadiazol-3-yl)naphthalen-2-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate |
| SMILES | CCCCOC(=O)CN(c1ccc2c(-c3noc(Cc4ccccc4)n3)cccc2c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C31H27Cl2N3O5S/c1-2-3-14-40-30(37)20-36(42(38,39)26-18-23(32)17-24(33)19-26)25-12-13-27-22(16-25)10-7-11-28(27)31-34-29(41-35-31)15-21-8-5-4-6-9-21/h4-13,16-19H,2-3,14-15,20H2,1H3 |
| InChIKey | UVBVKHNRUWJUPR-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.55 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|