C23H23Cl2N3O5S — CID 140570306
butyl 2-[(3,5-dichlorophenyl)sulfonyl-[5-[(Z)-N'-hydroxycarbamimidoyl]naphthalen-2-yl]amino]acetate (PubChem CID 140570306) has the molecular formula C23H23Cl2N3O5S and a molecular weight of 524.43 g/mol. Its IUPAC name is butyl 2-[(3,5-dichlorophenyl)sulfonyl-[5-[(Z)-N'-hydroxycarbamimidoyl]naphthalen-2-yl]amino]acetate.
| Compound Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[5-[(Z)-N'-hydroxycarbamimidoyl]naphthalen-2-yl]amino]acetate |
|---|---|
| PubChem CID | 140570306 |
| Molecular Formula | C23H23Cl2N3O5S |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[5-[(Z)-N'-hydroxycarbamimidoyl]naphthalen-2-yl]amino]acetate |
| SMILES | CCCCOC(=O)CN(c1ccc2c(/C(N)=N/O)cccc2c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H23Cl2N3O5S/c1-2-3-9-33-22(29)14-28(34(31,32)19-12-16(24)11-17(25)13-19)18-7-8-20-15(10-18)5-4-6-21(20)23(26)27-30/h4-8,10-13,30H,2-3,9,14H2,1H3,(H2,26,27) |
| InChIKey | RUMZBFGKAYKBPG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|