C29H27Cl2N3O5S — CID 90851206
butyl 2-[(3,5-dichlorophenyl)sulfonyl-[5-(pyridin-3-ylmethylcarbamoyl)naphthalen-2-yl]amino]acetate (PubChem CID 90851206) has the molecular formula C29H27Cl2N3O5S and a molecular weight of 600.52 g/mol. Its IUPAC name is butyl 2-[(3,5-dichlorophenyl)sulfonyl-[5-(pyridin-3-ylmethylcarbamoyl)naphthalen-2-yl]amino]acetate.
| Compound Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[5-(pyridin-3-ylmethylcarbamoyl)naphthalen-2-yl]amino]acetate |
|---|---|
| PubChem CID | 90851206 |
| Molecular Formula | C29H27Cl2N3O5S |
| Molecular Weight | 600.52 g/mol |
| Exact Mass | 599.10 |
| IUPAC Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[5-(pyridin-3-ylmethylcarbamoyl)naphthalen-2-yl]amino]acetate |
| SMILES | CCCCOC(=O)CN(c1ccc2c(C(=O)NCc3cccnc3)cccc2c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C29H27Cl2N3O5S/c1-2-3-12-39-28(35)19-34(40(37,38)25-15-22(30)14-23(31)16-25)24-9-10-26-21(13-24)7-4-8-27(26)29(36)33-18-20-6-5-11-32-17-20/h4-11,13-17H,2-3,12,18-19H2,1H3,(H,33,36) |
| InChIKey | JDLSJJDOBBGVLL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|