C22H22Cl2N2O5S2 — CID 91011559
butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(methylcarbamoyl)-1-benzothiophen-6-yl]amino]acetate (PubChem CID 91011559) has the molecular formula C22H22Cl2N2O5S2 and a molecular weight of 529.47 g/mol. Its IUPAC name is butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(methylcarbamoyl)-1-benzothiophen-6-yl]amino]acetate.
| Compound Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(methylcarbamoyl)-1-benzothiophen-6-yl]amino]acetate |
|---|---|
| PubChem CID | 91011559 |
| Molecular Formula | C22H22Cl2N2O5S2 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(methylcarbamoyl)-1-benzothiophen-6-yl]amino]acetate |
| SMILES | CCCCOC(=O)CN(c1ccc2c(C(=O)NC)csc2c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H22Cl2N2O5S2/c1-3-4-7-31-21(27)12-26(33(29,30)17-9-14(23)8-15(24)10-17)16-5-6-18-19(22(28)25-2)13-32-20(18)11-16/h5-6,8-11,13H,3-4,7,12H2,1-2H3,(H,25,28) |
| InChIKey | LNZWQFGBLCOAOF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|