C29H30Cl2N4O6S — CID 123478897
butyl 2-[(3,5-dichlorophenyl)sulfonyl-[5-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]naphthalen-2-yl]amino]acetate (PubChem CID 123478897) has the molecular formula C29H30Cl2N4O6S and a molecular weight of 633.55 g/mol. Its IUPAC name is butyl 2-[(3,5-dichlorophenyl)sulfonyl-[5-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]naphthalen-2-yl]amino]acetate.
| Compound Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[5-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]naphthalen-2-yl]amino]acetate |
|---|---|
| PubChem CID | 123478897 |
| Molecular Formula | C29H30Cl2N4O6S |
| Molecular Weight | 633.55 g/mol |
| Exact Mass | 632.13 |
| IUPAC Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[5-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]naphthalen-2-yl]amino]acetate |
| SMILES | CCCCOC(=O)CN(c1ccc2c(-c3noc(CN4CCOCC4)n3)cccc2c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C29H30Cl2N4O6S/c1-2-3-11-40-28(36)19-35(42(37,38)24-16-21(30)15-22(31)17-24)23-7-8-25-20(14-23)5-4-6-26(25)29-32-27(41-33-29)18-34-9-12-39-13-10-34/h4-8,14-17H,2-3,9-13,18-19H2,1H3 |
| InChIKey | NHYLUUVPSIDCTC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 115.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|