C26H22Cl3N3O4S — CID 123968515
butyl 2-[[5-(2-chloropyrimidin-4-yl)naphthalen-1-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate (PubChem CID 123968515) has the molecular formula C26H22Cl3N3O4S and a molecular weight of 578.91 g/mol. Its IUPAC name is butyl 2-[[5-(2-chloropyrimidin-4-yl)naphthalen-1-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate.
| Compound Name | butyl 2-[[5-(2-chloropyrimidin-4-yl)naphthalen-1-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 123968515 |
| Molecular Formula | C26H22Cl3N3O4S |
| Molecular Weight | 578.91 g/mol |
| Exact Mass | 577.04 |
| IUPAC Name | butyl 2-[[5-(2-chloropyrimidin-4-yl)naphthalen-1-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate |
| SMILES | CCCCOC(=O)CN(c1cccc2c(-c3ccnc(Cl)n3)cccc12)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C26H22Cl3N3O4S/c1-2-3-12-36-25(33)16-32(37(34,35)19-14-17(27)13-18(28)15-19)24-9-5-6-20-21(7-4-8-22(20)24)23-10-11-30-26(29)31-23/h4-11,13-15H,2-3,12,16H2,1H3 |
| InChIKey | KDKJFIKMMWDKEP-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.91 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|