C31H29Cl2N3O6S — CID 91287521
butyl 2-[[5-[(3-carbamoylphenyl)methylcarbamoyl]naphthalen-1-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate (PubChem CID 91287521) has the molecular formula C31H29Cl2N3O6S and a molecular weight of 642.56 g/mol. Its IUPAC name is butyl 2-[[5-[(3-carbamoylphenyl)methylcarbamoyl]naphthalen-1-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate.
| Compound Name | butyl 2-[[5-[(3-carbamoylphenyl)methylcarbamoyl]naphthalen-1-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 91287521 |
| Molecular Formula | C31H29Cl2N3O6S |
| Molecular Weight | 642.56 g/mol |
| Exact Mass | 641.12 |
| IUPAC Name | butyl 2-[[5-[(3-carbamoylphenyl)methylcarbamoyl]naphthalen-1-yl]-(3,5-dichlorophenyl)sulfonylamino]acetate |
| SMILES | CCCCOC(=O)CN(c1cccc2c(C(=O)NCc3cccc(C(N)=O)c3)cccc12)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C31H29Cl2N3O6S/c1-2-3-13-42-29(37)19-36(43(40,41)24-16-22(32)15-23(33)17-24)28-12-6-9-25-26(28)10-5-11-27(25)31(39)35-18-20-7-4-8-21(14-20)30(34)38/h4-12,14-17H,2-3,13,18-19H2,1H3,(H2,34,38)(H,35,39) |
| InChIKey | WNQUBMSPOSQGFN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|