C29H29Cl2N2O6PS — CID 59534066
N-benzyl-5-[(3,5-dichlorophenyl)sulfonyl-(diethoxyphosphorylmethyl)amino]naphthalene-1-carboxamide (PubChem CID 59534066) has the molecular formula C29H29Cl2N2O6PS and a molecular weight of 635.51 g/mol. Its IUPAC name is N-benzyl-5-[(3,5-dichlorophenyl)sulfonyl-(diethoxyphosphorylmethyl)amino]naphthalene-1-carboxamide.
| Compound Name | N-benzyl-5-[(3,5-dichlorophenyl)sulfonyl-(diethoxyphosphorylmethyl)amino]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 59534066 |
| Molecular Formula | C29H29Cl2N2O6PS |
| Molecular Weight | 635.51 g/mol |
| Exact Mass | 634.09 |
| IUPAC Name | N-benzyl-5-[(3,5-dichlorophenyl)sulfonyl-(diethoxyphosphorylmethyl)amino]naphthalene-1-carboxamide |
| SMILES | CCOP(=O)(CN(c1cccc2c(C(=O)NCc3ccccc3)cccc12)S(=O)(=O)c1cc(Cl)cc(Cl)c1)OCC |
| InChI | InChI=1S/C29H29Cl2N2O6PS/c1-3-38-40(35,39-4-2)20-33(41(36,37)24-17-22(30)16-23(31)18-24)28-15-9-12-25-26(28)13-8-14-27(25)29(34)32-19-21-10-6-5-7-11-21/h5-18H,3-4,19-20H2,1-2H3,(H,32,34) |
| InChIKey | JRYNMFRRUPYCPC-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.51 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|