C24H18Cl2N2O3S — CID 59534043
N-benzyl-1-[(3,5-dichlorophenyl)sulfonylamino]naphthalene-2-carboxamide (PubChem CID 59534043) has the molecular formula C24H18Cl2N2O3S and a molecular weight of 485.39 g/mol. Its IUPAC name is N-benzyl-1-[(3,5-dichlorophenyl)sulfonylamino]naphthalene-2-carboxamide.
| Compound Name | N-benzyl-1-[(3,5-dichlorophenyl)sulfonylamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 59534043 |
| Molecular Formula | C24H18Cl2N2O3S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | N-benzyl-1-[(3,5-dichlorophenyl)sulfonylamino]naphthalene-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc2ccccc2c1NS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C24H18Cl2N2O3S/c25-18-12-19(26)14-20(13-18)32(30,31)28-23-21-9-5-4-8-17(21)10-11-22(23)24(29)27-15-16-6-2-1-3-7-16/h1-14,28H,15H2,(H,27,29) |
| InChIKey | DSWUVURBSXGICA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |