C27H22Cl2N4O5S — CID 68972193
2-[[5-[(4-carbamimidoylphenyl)methylcarbamoyl]naphthalen-2-yl]-(3,5-dichlorophenyl)sulfonylamino]acetic acid (PubChem CID 68972193) has the molecular formula C27H22Cl2N4O5S and a molecular weight of 585.47 g/mol. Its IUPAC name is 2-[[5-[(4-carbamimidoylphenyl)methylcarbamoyl]naphthalen-2-yl]-(3,5-dichlorophenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[[5-[(4-carbamimidoylphenyl)methylcarbamoyl]naphthalen-2-yl]-(3,5-dichlorophenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 68972193 |
| Molecular Formula | C27H22Cl2N4O5S |
| Molecular Weight | 585.47 g/mol |
| Exact Mass | 584.07 |
| IUPAC Name | 2-[[5-[(4-carbamimidoylphenyl)methylcarbamoyl]naphthalen-2-yl]-(3,5-dichlorophenyl)sulfonylamino]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cccc3cc(N(CC(=O)O)S(=O)(=O)c4cc(Cl)cc(Cl)c4)ccc23)cc1 |
| InChI | InChI=1S/C27H22Cl2N4O5S/c28-19-11-20(29)13-22(12-19)39(37,38)33(15-25(34)35)21-8-9-23-18(10-21)2-1-3-24(23)27(36)32-14-16-4-6-17(7-5-16)26(30)31/h1-13H,14-15H2,(H3,30,31)(H,32,36)(H,34,35) |
| InChIKey | RQUXATWVEUGMTE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|