C25H22Cl2N4O3S — CID 67614478
N-[(4-carbamimidoylphenyl)methyl]-6-[(3-chlorophenyl)sulfonylamino]naphthalene-1-carboxamide;hydrochloride (PubChem CID 67614478) has the molecular formula C25H22Cl2N4O3S and a molecular weight of 529.45 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-6-[(3-chlorophenyl)sulfonylamino]naphthalene-1-carboxamide;hydrochloride.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-6-[(3-chlorophenyl)sulfonylamino]naphthalene-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67614478 |
| Molecular Formula | C25H22Cl2N4O3S |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-6-[(3-chlorophenyl)sulfonylamino]naphthalene-1-carboxamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CNC(=O)c2cccc3cc(NS(=O)(=O)c4cccc(Cl)c4)ccc23)cc1 |
| InChI | InChI=1S/C25H21ClN4O3S.ClH/c26-19-4-2-5-21(14-19)34(32,33)30-20-11-12-22-18(13-20)3-1-6-23(22)25(31)29-15-16-7-9-17(10-8-16)24(27)28;/h1-14,30H,15H2,(H3,27,28)(H,29,31);1H |
| InChIKey | IWRLPRRUTJAGMP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|