C26H20Cl2N2O3S — CID 143878796
2-[[5-(benzylcarbamoyl)naphthalen-1-yl]-(3,5-dichlorophenyl)sulfanylamino]acetic acid (PubChem CID 143878796) has the molecular formula C26H20Cl2N2O3S and a molecular weight of 511.43 g/mol. Its IUPAC name is 2-[[5-(benzylcarbamoyl)naphthalen-1-yl]-(3,5-dichlorophenyl)sulfanylamino]acetic acid.
| Compound Name | 2-[[5-(benzylcarbamoyl)naphthalen-1-yl]-(3,5-dichlorophenyl)sulfanylamino]acetic acid |
|---|---|
| PubChem CID | 143878796 |
| Molecular Formula | C26H20Cl2N2O3S |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | 2-[[5-(benzylcarbamoyl)naphthalen-1-yl]-(3,5-dichlorophenyl)sulfanylamino]acetic acid |
| SMILES | O=C(O)CN(Sc1cc(Cl)cc(Cl)c1)c1cccc2c(C(=O)NCc3ccccc3)cccc12 |
| InChI | InChI=1S/C26H20Cl2N2O3S/c27-18-12-19(28)14-20(13-18)34-30(16-25(31)32)24-11-5-8-21-22(24)9-4-10-23(21)26(33)29-15-17-6-2-1-3-7-17/h1-14H,15-16H2,(H,29,33)(H,31,32) |
| InChIKey | UBPDTZDVULXZHQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|