C33H33Cl2N3O4S — CID 143878847
tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-[[4-(dimethylcarbamoyl)phenyl]methylcarbamoyl]naphthalen-1-yl]amino]acetate (PubChem CID 143878847) has the molecular formula C33H33Cl2N3O4S and a molecular weight of 638.62 g/mol. Its IUPAC name is tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-[[4-(dimethylcarbamoyl)phenyl]methylcarbamoyl]naphthalen-1-yl]amino]acetate.
| Compound Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-[[4-(dimethylcarbamoyl)phenyl]methylcarbamoyl]naphthalen-1-yl]amino]acetate |
|---|---|
| PubChem CID | 143878847 |
| Molecular Formula | C33H33Cl2N3O4S |
| Molecular Weight | 638.62 g/mol |
| Exact Mass | 637.16 |
| IUPAC Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-[[4-(dimethylcarbamoyl)phenyl]methylcarbamoyl]naphthalen-1-yl]amino]acetate |
| SMILES | CN(C)C(=O)c1ccc(CNC(=O)c2cccc3c(N(CC(=O)OC(C)(C)C)Sc4cc(Cl)cc(Cl)c4)cccc23)cc1 |
| InChI | InChI=1S/C33H33Cl2N3O4S/c1-33(2,3)42-30(39)20-38(43-25-17-23(34)16-24(35)18-25)29-11-7-8-26-27(29)9-6-10-28(26)31(40)36-19-21-12-14-22(15-13-21)32(41)37(4)5/h6-18H,19-20H2,1-5H3,(H,36,40) |
| InChIKey | HFUQGIQXYHTSGM-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.62 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|