C29H26Cl2N2O3S — CID 143878808
tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-(phenylcarbamoyl)naphthalen-1-yl]amino]acetate (PubChem CID 143878808) has the molecular formula C29H26Cl2N2O3S and a molecular weight of 553.51 g/mol. Its IUPAC name is tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-(phenylcarbamoyl)naphthalen-1-yl]amino]acetate.
| Compound Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-(phenylcarbamoyl)naphthalen-1-yl]amino]acetate |
|---|---|
| PubChem CID | 143878808 |
| Molecular Formula | C29H26Cl2N2O3S |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-(phenylcarbamoyl)naphthalen-1-yl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(Sc1cc(Cl)cc(Cl)c1)c1cccc2c(C(=O)Nc3ccccc3)cccc12 |
| InChI | InChI=1S/C29H26Cl2N2O3S/c1-29(2,3)36-27(34)18-33(37-22-16-19(30)15-20(31)17-22)26-14-8-11-23-24(26)12-7-13-25(23)28(35)32-21-9-5-4-6-10-21/h4-17H,18H2,1-3H3,(H,32,35) |
| InChIKey | JCFDSJJQBIGXEO-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|