C25H18Cl2N2O3S — CID 143878936
2-[(3,5-dichlorophenyl)sulfanyl-[5-(phenylcarbamoyl)naphthalen-1-yl]amino]acetic acid (PubChem CID 143878936) has the molecular formula C25H18Cl2N2O3S and a molecular weight of 497.40 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)sulfanyl-[5-(phenylcarbamoyl)naphthalen-1-yl]amino]acetic acid.
| Compound Name | 2-[(3,5-dichlorophenyl)sulfanyl-[5-(phenylcarbamoyl)naphthalen-1-yl]amino]acetic acid |
|---|---|
| PubChem CID | 143878936 |
| Molecular Formula | C25H18Cl2N2O3S |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)sulfanyl-[5-(phenylcarbamoyl)naphthalen-1-yl]amino]acetic acid |
| SMILES | O=C(O)CN(Sc1cc(Cl)cc(Cl)c1)c1cccc2c(C(=O)Nc3ccccc3)cccc12 |
| InChI | InChI=1S/C25H18Cl2N2O3S/c26-16-12-17(27)14-19(13-16)33-29(15-24(30)31)23-11-5-8-20-21(23)9-4-10-22(20)25(32)28-18-6-2-1-3-7-18/h1-14H,15H2,(H,28,32)(H,30,31) |
| InChIKey | UDNRHLRZLASRER-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|