C34H26N2O4S2 — CID 154653313
2-[[4-[carboxymethyl(naphthalen-1-ylsulfanyl)amino]naphthalen-1-yl]-naphthalen-1-ylsulfanylamino]acetic acid (PubChem CID 154653313) has the molecular formula C34H26N2O4S2 and a molecular weight of 590.73 g/mol. Its IUPAC name is 2-[[4-[carboxymethyl(naphthalen-1-ylsulfanyl)amino]naphthalen-1-yl]-naphthalen-1-ylsulfanylamino]acetic acid.
| Compound Name | 2-[[4-[carboxymethyl(naphthalen-1-ylsulfanyl)amino]naphthalen-1-yl]-naphthalen-1-ylsulfanylamino]acetic acid |
|---|---|
| PubChem CID | 154653313 |
| Molecular Formula | C34H26N2O4S2 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.13 |
| IUPAC Name | 2-[[4-[carboxymethyl(naphthalen-1-ylsulfanyl)amino]naphthalen-1-yl]-naphthalen-1-ylsulfanylamino]acetic acid |
| SMILES | O=C(O)CN(Sc1cccc2ccccc12)c1ccc(N(CC(=O)O)Sc2cccc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C34H26N2O4S2/c37-33(38)21-35(41-31-17-7-11-23-9-1-3-13-25(23)31)29-19-20-30(28-16-6-5-15-27(28)29)36(22-34(39)40)42-32-18-8-12-24-10-2-4-14-26(24)32/h1-20H,21-22H2,(H,37,38)(H,39,40) |
| InChIKey | AKOZOTRVNDNOJM-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|