C21H22Cl2N2O2S — CID 89080219
tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-(7-methyl-1H-indol-5-yl)amino]acetate (PubChem CID 89080219) has the molecular formula C21H22Cl2N2O2S and a molecular weight of 437.39 g/mol. Its IUPAC name is tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-(7-methyl-1H-indol-5-yl)amino]acetate.
| Compound Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-(7-methyl-1H-indol-5-yl)amino]acetate |
|---|---|
| PubChem CID | 89080219 |
| Molecular Formula | C21H22Cl2N2O2S |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-(7-methyl-1H-indol-5-yl)amino]acetate |
| SMILES | Cc1cc(N(CC(=O)OC(C)(C)C)Sc2cc(Cl)cc(Cl)c2)cc2cc[nH]c12 |
| InChI | InChI=1S/C21H22Cl2N2O2S/c1-13-7-17(8-14-5-6-24-20(13)14)25(12-19(26)27-21(2,3)4)28-18-10-15(22)9-16(23)11-18/h5-11,24H,12H2,1-4H3 |
| InChIKey | LZGCFPPBPGRKTC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|