C30H30Cl2N4O3S — CID 143878778
tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-(2-morpholin-4-ylpyrimidin-5-yl)naphthalen-1-yl]amino]acetate (PubChem CID 143878778) has the molecular formula C30H30Cl2N4O3S and a molecular weight of 597.57 g/mol. Its IUPAC name is tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-(2-morpholin-4-ylpyrimidin-5-yl)naphthalen-1-yl]amino]acetate.
| Compound Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-(2-morpholin-4-ylpyrimidin-5-yl)naphthalen-1-yl]amino]acetate |
|---|---|
| PubChem CID | 143878778 |
| Molecular Formula | C30H30Cl2N4O3S |
| Molecular Weight | 597.57 g/mol |
| Exact Mass | 596.14 |
| IUPAC Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-(2-morpholin-4-ylpyrimidin-5-yl)naphthalen-1-yl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(Sc1cc(Cl)cc(Cl)c1)c1cccc2c(-c3cnc(N4CCOCC4)nc3)cccc12 |
| InChI | InChI=1S/C30H30Cl2N4O3S/c1-30(2,3)39-28(37)19-36(40-23-15-21(31)14-22(32)16-23)27-9-5-7-25-24(6-4-8-26(25)27)20-17-33-29(34-18-20)35-10-12-38-13-11-35/h4-9,14-18H,10-13,19H2,1-3H3 |
| InChIKey | GVSKTLHATYYWQF-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.57 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|