C35H35Cl2N3O5S — CID 143878814
tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-[[2-(morpholine-4-carbonyl)phenyl]methylcarbamoyl]naphthalen-1-yl]amino]acetate (PubChem CID 143878814) has the molecular formula C35H35Cl2N3O5S and a molecular weight of 680.65 g/mol. Its IUPAC name is tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-[[2-(morpholine-4-carbonyl)phenyl]methylcarbamoyl]naphthalen-1-yl]amino]acetate.
| Compound Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-[[2-(morpholine-4-carbonyl)phenyl]methylcarbamoyl]naphthalen-1-yl]amino]acetate |
|---|---|
| PubChem CID | 143878814 |
| Molecular Formula | C35H35Cl2N3O5S |
| Molecular Weight | 680.65 g/mol |
| Exact Mass | 679.17 |
| IUPAC Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfanyl-[5-[[2-(morpholine-4-carbonyl)phenyl]methylcarbamoyl]naphthalen-1-yl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(Sc1cc(Cl)cc(Cl)c1)c1cccc2c(C(=O)NCc3ccccc3C(=O)N3CCOCC3)cccc12 |
| InChI | InChI=1S/C35H35Cl2N3O5S/c1-35(2,3)45-32(41)22-40(46-26-19-24(36)18-25(37)20-26)31-13-7-10-28-29(31)11-6-12-30(28)33(42)38-21-23-8-4-5-9-27(23)34(43)39-14-16-44-17-15-39/h4-13,18-20H,14-17,21-22H2,1-3H3,(H,38,42) |
| InChIKey | CLNWWROAHGCWDH-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.65 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|