C24H21Cl2N3O3S — CID 88859828
2-[[1-(benzylcarbamoyl)-2,3-dihydroindol-5-yl]-(3,5-dichlorophenyl)sulfanylamino]acetic acid (PubChem CID 88859828) has the molecular formula C24H21Cl2N3O3S and a molecular weight of 502.42 g/mol. Its IUPAC name is 2-[[1-(benzylcarbamoyl)-2,3-dihydroindol-5-yl]-(3,5-dichlorophenyl)sulfanylamino]acetic acid.
| Compound Name | 2-[[1-(benzylcarbamoyl)-2,3-dihydroindol-5-yl]-(3,5-dichlorophenyl)sulfanylamino]acetic acid |
|---|---|
| PubChem CID | 88859828 |
| Molecular Formula | C24H21Cl2N3O3S |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 2-[[1-(benzylcarbamoyl)-2,3-dihydroindol-5-yl]-(3,5-dichlorophenyl)sulfanylamino]acetic acid |
| SMILES | O=C(O)CN(Sc1cc(Cl)cc(Cl)c1)c1ccc2c(c1)CCN2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H21Cl2N3O3S/c25-18-11-19(26)13-21(12-18)33-29(15-23(30)31)20-6-7-22-17(10-20)8-9-28(22)24(32)27-14-16-4-2-1-3-5-16/h1-7,10-13H,8-9,14-15H2,(H,27,32)(H,30,31) |
| InChIKey | VYPQOVXLLKZRMQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|