C22H18Cl2N2OS — CID 89244567
1-[5-[(3,5-dichlorophenyl)sulfanylamino]-2,3-dihydroindol-1-yl]-2-phenylethanone (PubChem CID 89244567) has the molecular formula C22H18Cl2N2OS and a molecular weight of 429.37 g/mol. Its IUPAC name is 1-[5-[(3,5-dichlorophenyl)sulfanylamino]-2,3-dihydroindol-1-yl]-2-phenylethanone.
| Compound Name | 1-[5-[(3,5-dichlorophenyl)sulfanylamino]-2,3-dihydroindol-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 89244567 |
| Molecular Formula | C22H18Cl2N2OS |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 1-[5-[(3,5-dichlorophenyl)sulfanylamino]-2,3-dihydroindol-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CCc2cc(NSc3cc(Cl)cc(Cl)c3)ccc21 |
| InChI | InChI=1S/C22H18Cl2N2OS/c23-17-12-18(24)14-20(13-17)28-25-19-6-7-21-16(11-19)8-9-26(21)22(27)10-15-4-2-1-3-5-15/h1-7,11-14,25H,8-10H2 |
| InChIKey | SQDULBWGTAQMAK-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|