C19H15ClN2O2 — CID 167947111
3-[2-(5-chloro-2,3-dihydroindol-1-yl)-2-oxoethyl]-1H-quinolin-2-one (PubChem CID 167947111) has the molecular formula C19H15ClN2O2 and a molecular weight of 338.79 g/mol. Its IUPAC name is 3-[2-(5-chloro-2,3-dihydroindol-1-yl)-2-oxoethyl]-1H-quinolin-2-one.
| Compound Name | 3-[2-(5-chloro-2,3-dihydroindol-1-yl)-2-oxoethyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 167947111 |
| Molecular Formula | C19H15ClN2O2 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 3-[2-(5-chloro-2,3-dihydroindol-1-yl)-2-oxoethyl]-1H-quinolin-2-one |
| SMILES | O=C(Cc1cc2ccccc2[nH]c1=O)N1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H15ClN2O2/c20-15-5-6-17-13(10-15)7-8-22(17)18(23)11-14-9-12-3-1-2-4-16(12)21-19(14)24/h1-6,9-10H,7-8,11H2,(H,21,24) |
| InChIKey | BEYFQKSTGNJRNM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |