C17H20N2O3 — CID 95584393
3-[2-[(2S,5S)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]-1H-quinolin-2-one (PubChem CID 95584393) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-[2-[(2S,5S)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]-1H-quinolin-2-one.
| Compound Name | 3-[2-[(2S,5S)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 95584393 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3-[2-[(2S,5S)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]-1H-quinolin-2-one |
| SMILES | C[C@H]1CN(C(=O)Cc2cc3ccccc3[nH]c2=O)[C@@H](C)CO1 |
| InChI | InChI=1S/C17H20N2O3/c1-11-10-22-12(2)9-19(11)16(20)8-14-7-13-5-3-4-6-15(13)18-17(14)21/h3-7,11-12H,8-10H2,1-2H3,(H,18,21)/t11-,12-/m0/s1 |
| InChIKey | XKIXCIBDXXQOTF-RYUDHWBXSA-N |
| XLogP | 1.71 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |