C19H22N2O3 — CID 56817964
3-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-oxoethyl]-1H-quinolin-2-one (PubChem CID 56817964) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-oxoethyl]-1H-quinolin-2-one.
| Compound Name | 3-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-oxoethyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 56817964 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 3-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-oxoethyl]-1H-quinolin-2-one |
| SMILES | O=C(Cc1cc2ccccc2[nH]c1=O)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C19H22N2O3/c22-18(21-9-10-24-17-8-4-3-7-16(17)21)12-14-11-13-5-1-2-6-15(13)20-19(14)23/h1-2,5-6,11,16-17H,3-4,7-10,12H2,(H,20,23) |
| InChIKey | HPPOVVRYCFAHOE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |