C19H22N2OS — CID 177246549
1-[5-[(4-propylphenyl)sulfanylamino]-2,3-dihydroindol-1-yl]ethanone (PubChem CID 177246549) has the molecular formula C19H22N2OS and a molecular weight of 326.47 g/mol. Its IUPAC name is 1-[5-[(4-propylphenyl)sulfanylamino]-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-[(4-propylphenyl)sulfanylamino]-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 177246549 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-[5-[(4-propylphenyl)sulfanylamino]-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CCCc1ccc(SNc2ccc3c(c2)CCN3C(C)=O)cc1 |
| InChI | InChI=1S/C19H22N2OS/c1-3-4-15-5-8-18(9-6-15)23-20-17-7-10-19-16(13-17)11-12-21(19)14(2)22/h5-10,13,20H,3-4,11-12H2,1-2H3 |
| InChIKey | CLWKFRXRTCAQMS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|